About 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine
1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 61324179) has the molecular formula C11H21N3O
and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine |
| PubChem CID | 61324179 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | CCCCC(CC)c1nc(C(C)N)no1 |
| InChI | InChI=1S/C11H21N3O/c1-4-6-7-9(5-2)11-13-10(8(3)12)14-15-11/h8-9H,4-7,12H2,1-3H3 |
| InChIKey | BAMSHCVLOFJJTG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine?
The IUPAC name of 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine (CID 61324179) is 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine.
What is the SMILES notation for 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine?
The canonical SMILES for 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine is CCCCC(CC)c1nc(C(C)N)no1.
What is the InChIKey of 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine?
The InChIKey is BAMSHCVLOFJJTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O/c1-4-6-7-9(5-2)11-13-10(8(3)12)14-15-11/h8-9H,4-7,12H2,1-3H3.
What are the key properties of 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine?
1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine has a molecular weight of 211.31 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-heptan-3-yl-1,2,4-oxadiazol-3-yl)ethanamine is sourced from PubChem (CID 61324179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).