C13H21N3O3 — CID 61324907
4-(2-imidazol-1-ylethylamino)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 61324907) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(2-imidazol-1-ylethylamino)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-(2-imidazol-1-ylethylamino)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 61324907 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-(2-imidazol-1-ylethylamino)-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C(C)(CC(=O)NCCn1ccnc1)C(=O)O |
| InChI | InChI=1S/C13H21N3O3/c1-10(2)13(3,12(18)19)8-11(17)15-5-7-16-6-4-14-9-16/h4,6,9-10H,5,7-8H2,1-3H3,(H,15,17)(H,18,19) |
| InChIKey | NJBBAIGCVJRPGL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |