About 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine
3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine (PubChem CID 61325906) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine.
Molecular Properties
| Compound Name | 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine |
| PubChem CID | 61325906 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine |
| SMILES | CCc1ccc(-c2nc(C(N)(CC)CC)no2)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-4-11-7-9-12(10-8-11)13-17-14(18-19-13)15(16,5-2)6-3/h7-10H,4-6,16H2,1-3H3 |
| InChIKey | KHNVCIHHOWANSA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine?
The IUPAC name of 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine (CID 61325906) is 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine.
What is the SMILES notation for 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine?
The canonical SMILES for 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine is CCc1ccc(-c2nc(C(N)(CC)CC)no2)cc1.
What is the InChIKey of 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine?
The InChIKey is KHNVCIHHOWANSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-4-11-7-9-12(10-8-11)13-17-14(18-19-13)15(16,5-2)6-3/h7-10H,4-6,16H2,1-3H3.
What are the key properties of 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine?
3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine has a molecular weight of 259.35 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-ethylphenyl)-1,2,4-oxadiazol-3-yl]pentan-3-amine is sourced from PubChem (CID 61325906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).