About 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine
2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine (PubChem CID 61326285) has the molecular formula C11H12IN3O
and a molecular weight of 329.14 g/mol. Its IUPAC name is 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
Molecular Properties
| Compound Name | 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| PubChem CID | 61326285 |
| Molecular Formula | C11H12IN3O |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine |
| SMILES | CC(C)(N)c1noc(-c2ccc(I)cc2)n1 |
| InChI | InChI=1S/C11H12IN3O/c1-11(2,13)10-14-9(16-15-10)7-3-5-8(12)6-4-7/h3-6H,13H2,1-2H3 |
| InChIKey | FIYYBNJUXXAMCC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine?
The IUPAC name of 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine (CID 61326285) is 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine.
What is the SMILES notation for 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine?
The canonical SMILES for 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine is CC(C)(N)c1noc(-c2ccc(I)cc2)n1.
What is the InChIKey of 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine?
The InChIKey is FIYYBNJUXXAMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12IN3O/c1-11(2,13)10-14-9(16-15-10)7-3-5-8(12)6-4-7/h3-6H,13H2,1-2H3.
What are the key properties of 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine?
2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine has a molecular weight of 329.14 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-iodophenyl)-1,2,4-oxadiazol-3-yl]propan-2-amine is sourced from PubChem (CID 61326285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).