C12H13NO4 — CID 61328165
4-(2-hydroxy-2-phenylethyl)morpholine-3,5-dione (PubChem CID 61328165) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(2-hydroxy-2-phenylethyl)morpholine-3,5-dione.
| Compound Name | 4-(2-hydroxy-2-phenylethyl)morpholine-3,5-dione |
|---|---|
| PubChem CID | 61328165 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(2-hydroxy-2-phenylethyl)morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1CC(O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO4/c14-10(9-4-2-1-3-5-9)6-13-11(15)7-17-8-12(13)16/h1-5,10,14H,6-8H2 |
| InChIKey | FNNXDXNTIHXYEB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|