About 1,5-diphenylpyrazole
1,5-diphenylpyrazole (PubChem CID 613283) has the molecular formula C15H12N2
and a molecular weight of 220.28 g/mol. Its IUPAC name is 1,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 1,5-diphenylpyrazole |
| PubChem CID | 613283 |
| Molecular Formula | C15H12N2 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1,5-diphenylpyrazole |
| SMILES | c1ccc(-c2ccnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2/c1-3-7-13(8-4-1)15-11-12-16-17(15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | IDCXLYCLPHRSAZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diphenylpyrazole?
The IUPAC name of 1,5-diphenylpyrazole (CID 613283) is 1,5-diphenylpyrazole.
What is the SMILES notation for 1,5-diphenylpyrazole?
The canonical SMILES for 1,5-diphenylpyrazole is c1ccc(-c2ccnn2-c2ccccc2)cc1.
What is the InChIKey of 1,5-diphenylpyrazole?
The InChIKey is IDCXLYCLPHRSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2/c1-3-7-13(8-4-1)15-11-12-16-17(15)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 1,5-diphenylpyrazole?
1,5-diphenylpyrazole has a molecular weight of 220.28 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diphenylpyrazole is sourced from PubChem (CID 613283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).