C13H17N3O5 — CID 61329220
2-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethoxy]acetic acid (PubChem CID 61329220) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329220 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[2-[(6-morpholin-4-yl-3-pyridinyl)amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C13H17N3O5/c17-12(8-21-9-13(18)19)15-10-1-2-11(14-7-10)16-3-5-20-6-4-16/h1-2,7H,3-6,8-9H2,(H,15,17)(H,18,19) |
| InChIKey | VPPXOTRPXZAHCL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |