C12H10ClNO6 — CID 61329519
5-chloro-4-(3,5-dioxomorpholin-4-yl)-2-methoxybenzoic acid (PubChem CID 61329519) has the molecular formula C12H10ClNO6 and a molecular weight of 299.67 g/mol. Its IUPAC name is 5-chloro-4-(3,5-dioxomorpholin-4-yl)-2-methoxybenzoic acid.
| Compound Name | 5-chloro-4-(3,5-dioxomorpholin-4-yl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 61329519 |
| Molecular Formula | C12H10ClNO6 |
| Molecular Weight | 299.67 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 5-chloro-4-(3,5-dioxomorpholin-4-yl)-2-methoxybenzoic acid |
| SMILES | COc1cc(N2C(=O)COCC2=O)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C12H10ClNO6/c1-19-9-3-8(7(13)2-6(9)12(17)18)14-10(15)4-20-5-11(14)16/h2-3H,4-5H2,1H3,(H,17,18) |
| InChIKey | HUXWZQOOZIBIMQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.67 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|