C12H10N2O6 — CID 61329534
2-[2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-2-oxoethoxy]acetic acid (PubChem CID 61329534) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is 2-[2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329534 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[2-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C12H10N2O6/c15-9(4-20-5-10(16)17)6-1-2-7-8(3-6)14-12(19)11(18)13-7/h1-3H,4-5H2,(H,13,18)(H,14,19)(H,16,17) |
| InChIKey | AFJURSZHBHMNAM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 129.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|