C10H17NO5 — CID 61329813
2-[2-[(3-hydroxycyclohexyl)amino]-2-oxoethoxy]acetic acid (PubChem CID 61329813) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[2-[(3-hydroxycyclohexyl)amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(3-hydroxycyclohexyl)amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329813 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-[2-[(3-hydroxycyclohexyl)amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NC1CCCC(O)C1 |
| InChI | InChI=1S/C10H17NO5/c12-8-3-1-2-7(4-8)11-9(13)5-16-6-10(14)15/h7-8,12H,1-6H2,(H,11,13)(H,14,15) |
| InChIKey | XUCBZDFVAZSOKJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |