C17H22N2S — CID 61330106
4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl-(2,4,6-trimethylphenyl)methanamine (PubChem CID 61330106) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl-(2,4,6-trimethylphenyl)methanamine.
| Compound Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl-(2,4,6-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 61330106 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl-(2,4,6-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)c2nc3c(s2)CCCC3)c(C)c1 |
| InChI | InChI=1S/C17H22N2S/c1-10-8-11(2)15(12(3)9-10)16(18)17-19-13-6-4-5-7-14(13)20-17/h8-9,16H,4-7,18H2,1-3H3 |
| InChIKey | YBJOUBOBBDKMAZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |