About N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine
N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine (PubChem CID 61330202) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine.
Molecular Properties
| Compound Name | N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine |
| PubChem CID | 61330202 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine |
| SMILES | CCNC(CC)(CC(C)CC)c1nccs1 |
| InChI | InChI=1S/C13H24N2S/c1-5-11(4)10-13(6-2,15-7-3)12-14-8-9-16-12/h8-9,11,15H,5-7,10H2,1-4H3 |
| InChIKey | DGOLEGZTFVCIOU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine?
The IUPAC name of N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine (CID 61330202) is N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine.
What is the SMILES notation for N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine?
The canonical SMILES for N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine is CCNC(CC)(CC(C)CC)c1nccs1.
What is the InChIKey of N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine?
The InChIKey is DGOLEGZTFVCIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c1-5-11(4)10-13(6-2,15-7-3)12-14-8-9-16-12/h8-9,11,15H,5-7,10H2,1-4H3.
What are the key properties of N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine?
N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine has a molecular weight of 240.42 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-methyl-3-(1,3-thiazol-2-yl)heptan-3-amine is sourced from PubChem (CID 61330202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).