About 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine
3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 61330650) has the molecular formula C14H23N3S
and a molecular weight of 265.43 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine.
Molecular Properties
| Compound Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine |
| PubChem CID | 61330650 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | CCCNC1(c2nc(C)cs2)CN2CCC1CC2 |
| InChI | InChI=1S/C14H23N3S/c1-3-6-15-14(13-16-11(2)9-18-13)10-17-7-4-12(14)5-8-17/h9,12,15H,3-8,10H2,1-2H3 |
| InChIKey | FFIVWXFPEOEDFA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine?
The IUPAC name of 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine (CID 61330650) is 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine.
What is the SMILES notation for 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine?
The canonical SMILES for 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine is CCCNC1(c2nc(C)cs2)CN2CCC1CC2.
What is the InChIKey of 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine?
The InChIKey is FFIVWXFPEOEDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3S/c1-3-6-15-14(13-16-11(2)9-18-13)10-17-7-4-12(14)5-8-17/h9,12,15H,3-8,10H2,1-2H3.
What are the key properties of 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine?
3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine has a molecular weight of 265.43 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methyl-1,3-thiazol-2-yl)-N-propyl-1-azabicyclo[2.2.2]octan-3-amine is sourced from PubChem (CID 61330650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).