C13H22N2S — CID 61332281
1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-1-amine (PubChem CID 61332281) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-1-amine.
| Compound Name | 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 61332281 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)hexan-1-amine |
| SMILES | CCCCCC(N)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H22N2S/c1-2-3-4-7-10(14)13-15-11-8-5-6-9-12(11)16-13/h10H,2-9,14H2,1H3 |
| InChIKey | FJAGPGHZHIVNDC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|