C16H22N2OS — CID 61332859
(4-tert-butyl-1,3-thiazol-2-yl)-(2-ethoxyphenyl)methanamine (PubChem CID 61332859) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is (4-tert-butyl-1,3-thiazol-2-yl)-(2-ethoxyphenyl)methanamine.
| Compound Name | (4-tert-butyl-1,3-thiazol-2-yl)-(2-ethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 61332859 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (4-tert-butyl-1,3-thiazol-2-yl)-(2-ethoxyphenyl)methanamine |
| SMILES | CCOc1ccccc1C(N)c1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H22N2OS/c1-5-19-12-9-7-6-8-11(12)14(17)15-18-13(10-20-15)16(2,3)4/h6-10,14H,5,17H2,1-4H3 |
| InChIKey | WDDXEMBEOBQBAQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |