About 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde
1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde (PubChem CID 61333386) has the molecular formula C14H16N2O3S2
and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde |
| PubChem CID | 61333386 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde |
| SMILES | CCc1ccc(-c2nn(C3CCS(=O)(=O)C3)cc2C=O)s1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-2-12-3-4-13(20-12)14-10(8-17)7-16(15-14)11-5-6-21(18,19)9-11/h3-4,7-8,11H,2,5-6,9H2,1H3 |
| InChIKey | FSMDCIVSWSFUTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde (CID 61333386) is 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde is CCc1ccc(-c2nn(C3CCS(=O)(=O)C3)cc2C=O)s1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde?
The InChIKey is FSMDCIVSWSFUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3S2/c1-2-12-3-4-13(20-12)14-10(8-17)7-16(15-14)11-5-6-21(18,19)9-11/h3-4,7-8,11H,2,5-6,9H2,1H3.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde?
1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde has a molecular weight of 324.43 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-3-(5-ethylthiophen-2-yl)pyrazole-4-carbaldehyde is sourced from PubChem (CID 61333386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).