C17H24N2S — CID 61333939
4-[[1-(5-ethylthiophen-2-yl)ethylamino]methyl]-N,N-dimethylaniline (PubChem CID 61333939) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 4-[[1-(5-ethylthiophen-2-yl)ethylamino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(5-ethylthiophen-2-yl)ethylamino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 61333939 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-[[1-(5-ethylthiophen-2-yl)ethylamino]methyl]-N,N-dimethylaniline |
| SMILES | CCc1ccc(C(C)NCc2ccc(N(C)C)cc2)s1 |
| InChI | InChI=1S/C17H24N2S/c1-5-16-10-11-17(20-16)13(2)18-12-14-6-8-15(9-7-14)19(3)4/h6-11,13,18H,5,12H2,1-4H3 |
| InChIKey | OEOBOQCGVRHORA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|