About N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine
N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine (PubChem CID 61334262) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine |
| PubChem CID | 61334262 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine |
| SMILES | CC(NC1CC1)(c1nccs1)C1CC1 |
| InChI | InChI=1S/C11H16N2S/c1-11(8-2-3-8,13-9-4-5-9)10-12-6-7-14-10/h6-9,13H,2-5H2,1H3 |
| InChIKey | URLLFRIPTAGGBX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine?
The IUPAC name of N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine (CID 61334262) is N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine.
What is the SMILES notation for N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine?
The canonical SMILES for N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine is CC(NC1CC1)(c1nccs1)C1CC1.
What is the InChIKey of N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine?
The InChIKey is URLLFRIPTAGGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c1-11(8-2-3-8,13-9-4-5-9)10-12-6-7-14-10/h6-9,13H,2-5H2,1H3.
What are the key properties of N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine?
N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine has a molecular weight of 208.33 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-cyclopropyl-1-(1,3-thiazol-2-yl)ethyl]cyclopropanamine is sourced from PubChem (CID 61334262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).