C10H13N3S — CID 61336540
3-propyl-5-(thiophen-2-ylmethyl)-1H-1,2,4-triazole (PubChem CID 61336540) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 3-propyl-5-(thiophen-2-ylmethyl)-1H-1,2,4-triazole.
| Compound Name | 3-propyl-5-(thiophen-2-ylmethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61336540 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-propyl-5-(thiophen-2-ylmethyl)-1H-1,2,4-triazole |
| SMILES | CCCc1n[nH]c(Cc2cccs2)n1 |
| InChI | InChI=1S/C10H13N3S/c1-2-4-9-11-10(13-12-9)7-8-5-3-6-14-8/h3,5-6H,2,4,7H2,1H3,(H,11,12,13) |
| InChIKey | ZTYYKKMBFROTSK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |