C16H21N3O2 — CID 61336565
5-cyclohexyl-3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazole (PubChem CID 61336565) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 5-cyclohexyl-3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 5-cyclohexyl-3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61336565 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 5-cyclohexyl-3-(2,6-dimethoxyphenyl)-1H-1,2,4-triazole |
| SMILES | COc1cccc(OC)c1-c1n[nH]c(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H21N3O2/c1-20-12-9-6-10-13(21-2)14(12)16-17-15(18-19-16)11-7-4-3-5-8-11/h6,9-11H,3-5,7-8H2,1-2H3,(H,17,18,19) |
| InChIKey | DUBKOMPSWPMTJT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |