About 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole
3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole (PubChem CID 61336782) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole |
| PubChem CID | 61336782 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole |
| SMILES | CCCc1nc(C2CC(OC)CN2)n[nH]1 |
| InChI | InChI=1S/C10H18N4O/c1-3-4-9-12-10(14-13-9)8-5-7(15-2)6-11-8/h7-8,11H,3-6H2,1-2H3,(H,12,13,14) |
| InChIKey | ZDXLWNVQSFUFSO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole?
The IUPAC name of 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole (CID 61336782) is 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole.
What is the SMILES notation for 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole?
The canonical SMILES for 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole is CCCc1nc(C2CC(OC)CN2)n[nH]1.
What is the InChIKey of 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole?
The InChIKey is ZDXLWNVQSFUFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-3-4-9-12-10(14-13-9)8-5-7(15-2)6-11-8/h7-8,11H,3-6H2,1-2H3,(H,12,13,14).
What are the key properties of 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole?
3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole has a molecular weight of 210.28 g/mol, XLogP of 0.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxypyrrolidin-2-yl)-5-propyl-1H-1,2,4-triazole is sourced from PubChem (CID 61336782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).