C14H15F2N3 — CID 61336958
5-cyclohexyl-3-(3,5-difluorophenyl)-1H-1,2,4-triazole (PubChem CID 61336958) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-cyclohexyl-3-(3,5-difluorophenyl)-1H-1,2,4-triazole.
| Compound Name | 5-cyclohexyl-3-(3,5-difluorophenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61336958 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5-cyclohexyl-3-(3,5-difluorophenyl)-1H-1,2,4-triazole |
| SMILES | Fc1cc(F)cc(-c2n[nH]c(C3CCCCC3)n2)c1 |
| InChI | InChI=1S/C14H15F2N3/c15-11-6-10(7-12(16)8-11)14-17-13(18-19-14)9-4-2-1-3-5-9/h6-9H,1-5H2,(H,17,18,19) |
| InChIKey | VWXYJBRGMCFKCM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |