About cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine
cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine (PubChem CID 61337248) has the molecular formula C13H12F2N2S
and a molecular weight of 266.32 g/mol. Its IUPAC name is cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine.
Molecular Properties
| Compound Name | cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine |
| PubChem CID | 61337248 |
| Molecular Formula | C13H12F2N2S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine |
| SMILES | NC(c1nc(-c2c(F)cccc2F)cs1)C1CC1 |
| InChI | InChI=1S/C13H12F2N2S/c14-8-2-1-3-9(15)11(8)10-6-18-13(17-10)12(16)7-4-5-7/h1-3,6-7,12H,4-5,16H2 |
| InChIKey | WCUNWYQJPTYQAH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine?
The IUPAC name of cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine (CID 61337248) is cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine.
What is the SMILES notation for cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine?
The canonical SMILES for cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine is NC(c1nc(-c2c(F)cccc2F)cs1)C1CC1.
What is the InChIKey of cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine?
The InChIKey is WCUNWYQJPTYQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2S/c14-8-2-1-3-9(15)11(8)10-6-18-13(17-10)12(16)7-4-5-7/h1-3,6-7,12H,4-5,16H2.
What are the key properties of cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine?
cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine has a molecular weight of 266.32 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-[4-(2,6-difluorophenyl)-1,3-thiazol-2-yl]methanamine is sourced from PubChem (CID 61337248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).