About 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 61337483) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| PubChem CID | 61337483 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | CCc1nc(C2(N)CCCCC2)sc1C |
| InChI | InChI=1S/C12H20N2S/c1-3-10-9(2)15-11(14-10)12(13)7-5-4-6-8-12/h3-8,13H2,1-2H3 |
| InChIKey | DANIHEGFAFGEMM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The IUPAC name of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine (CID 61337483) is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine.
What is the SMILES notation for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The canonical SMILES for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine is CCc1nc(C2(N)CCCCC2)sc1C.
What is the InChIKey of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The InChIKey is DANIHEGFAFGEMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2S/c1-3-10-9(2)15-11(14-10)12(13)7-5-4-6-8-12/h3-8,13H2,1-2H3.
What are the key properties of 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine has a molecular weight of 224.37 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine is sourced from PubChem (CID 61337483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).