C16H20N4 — CID 61338165
5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole (PubChem CID 61338165) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole.
| Compound Name | 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 61338165 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1-c1n[nH]c(C3CCCCC3)n1)CCN2 |
| InChI | InChI=1S/C16H20N4/c1-2-4-11(5-3-1)15-18-16(20-19-15)13-6-7-14-12(10-13)8-9-17-14/h6-7,10-11,17H,1-5,8-9H2,(H,18,19,20) |
| InChIKey | ZUZNDNVWANAWLX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |