C16H22N4 — CID 61338708
4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-dimethylaniline (PubChem CID 61338708) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 61338708 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2n[nH]c(C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C16H22N4/c1-20(2)14-10-8-13(9-11-14)16-17-15(18-19-16)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | MRYWJHBXMPFQPS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |