About N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine
N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine (PubChem CID 61338734) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine |
| PubChem CID | 61338734 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine |
| SMILES | CC(C)NCCc1nc(C2CCCC2)n[nH]1 |
| InChI | InChI=1S/C12H22N4/c1-9(2)13-8-7-11-14-12(16-15-11)10-5-3-4-6-10/h9-10,13H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | TVHQOTKRZQKHOT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine?
The IUPAC name of N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine (CID 61338734) is N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine.
What is the SMILES notation for N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine?
The canonical SMILES for N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine is CC(C)NCCc1nc(C2CCCC2)n[nH]1.
What is the InChIKey of N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine?
The InChIKey is TVHQOTKRZQKHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-9(2)13-8-7-11-14-12(16-15-11)10-5-3-4-6-10/h9-10,13H,3-8H2,1-2H3,(H,14,15,16).
What are the key properties of N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine?
N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine has a molecular weight of 222.34 g/mol, XLogP of 2.00, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)ethyl]propan-2-amine is sourced from PubChem (CID 61338734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).