About (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol
(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol (PubChem CID 61338898) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol |
| PubChem CID | 61338898 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol |
| SMILES | OCc1nc(C2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C9H15N3O/c13-6-8-10-9(12-11-8)7-4-2-1-3-5-7/h7,13H,1-6H2,(H,10,11,12) |
| InChIKey | GIGSSSVXHYDZHX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol?
The IUPAC name of (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol (CID 61338898) is (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol.
What is the SMILES notation for (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol?
The canonical SMILES for (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol is OCc1nc(C2CCCCC2)n[nH]1.
What is the InChIKey of (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol?
The InChIKey is GIGSSSVXHYDZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c13-6-8-10-9(12-11-8)7-4-2-1-3-5-7/h7,13H,1-6H2,(H,10,11,12).
What are the key properties of (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol?
(3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol has a molecular weight of 181.24 g/mol, XLogP of 1.34, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclohexyl-1H-1,2,4-triazol-5-yl)methanol is sourced from PubChem (CID 61338898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).