C17H24N4 — CID 61339126
N-[2-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)ethyl]-2-methylaniline (PubChem CID 61339126) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-[2-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)ethyl]-2-methylaniline.
| Compound Name | N-[2-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)ethyl]-2-methylaniline |
|---|---|
| PubChem CID | 61339126 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-[2-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)ethyl]-2-methylaniline |
| SMILES | Cc1ccccc1NCCc1nc(C2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C17H24N4/c1-13-7-5-6-10-15(13)18-12-11-16-19-17(21-20-16)14-8-3-2-4-9-14/h5-7,10,14,18H,2-4,8-9,11-12H2,1H3,(H,19,20,21) |
| InChIKey | QZOWPCIZBOJMKL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |