About 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine
1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine (PubChem CID 61339173) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine |
| PubChem CID | 61339173 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine |
| SMILES | CCCC(N)c1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C11H14N2OS/c1-2-4-8(12)11-13-9(7-15-11)10-5-3-6-14-10/h3,5-8H,2,4,12H2,1H3 |
| InChIKey | WZESIPPKQLHNAA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine?
The IUPAC name of 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine (CID 61339173) is 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine.
What is the SMILES notation for 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine?
The canonical SMILES for 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine is CCCC(N)c1nc(-c2ccco2)cs1.
What is the InChIKey of 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine?
The InChIKey is WZESIPPKQLHNAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-2-4-8(12)11-13-9(7-15-11)10-5-3-6-14-10/h3,5-8H,2,4,12H2,1H3.
What are the key properties of 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine?
1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine has a molecular weight of 222.31 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(furan-2-yl)-1,3-thiazol-2-yl]butan-1-amine is sourced from PubChem (CID 61339173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).