C19H36NO3P — CID 613401
2-[cyclohexyl(methoxy)phosphoryl]-N-(5-methyl-2-propan-2-ylcyclohexyl)acetamide (PubChem CID 613401) has the molecular formula C19H36NO3P and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[cyclohexyl(methoxy)phosphoryl]-N-(5-methyl-2-propan-2-ylcyclohexyl)acetamide.
| Compound Name | 2-[cyclohexyl(methoxy)phosphoryl]-N-(5-methyl-2-propan-2-ylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 613401 |
| Molecular Formula | C19H36NO3P |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-[cyclohexyl(methoxy)phosphoryl]-N-(5-methyl-2-propan-2-ylcyclohexyl)acetamide |
| SMILES | COP(=O)(CC(=O)NC1CC(C)CCC1C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C19H36NO3P/c1-14(2)17-11-10-15(3)12-18(17)20-19(21)13-24(22,23-4)16-8-6-5-7-9-16/h14-18H,5-13H2,1-4H3,(H,20,21) |
| InChIKey | GOYDLLNEUGNIFP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|