C15H25N3O — CID 61341881
1-(2,2-dimethylpropyl)-3-[4-[1-(methylamino)ethyl]phenyl]urea (PubChem CID 61341881) has the molecular formula C15H25N3O and a molecular weight of 263.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-[4-[1-(methylamino)ethyl]phenyl]urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-[4-[1-(methylamino)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 61341881 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-[4-[1-(methylamino)ethyl]phenyl]urea |
| SMILES | CNC(C)c1ccc(NC(=O)NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H25N3O/c1-11(16-5)12-6-8-13(9-7-12)18-14(19)17-10-15(2,3)4/h6-9,11,16H,10H2,1-5H3,(H2,17,18,19) |
| InChIKey | QEHZHOBDCSOBFC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |