C8H9F3N4O — CID 61341904
1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 61341904) has the molecular formula C8H9F3N4O and a molecular weight of 234.18 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 61341904 |
| Molecular Formula | C8H9F3N4O |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(CCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H9F3N4O/c9-8(10,11)5-16-3-1-2-15-6-13-7(4-12)14-15/h6H,1-3,5H2 |
| InChIKey | VRVSTMDOSATIAL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|