C14H16N2O5 — CID 61343515
ethyl 2-[(3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]propanoate (PubChem CID 61343515) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl 2-[(3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]propanoate.
| Compound Name | ethyl 2-[(3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 61343515 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 2-[(3-oxo-4H-1,4-benzoxazine-7-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C14H16N2O5/c1-3-20-14(19)8(2)15-13(18)9-4-5-10-11(6-9)21-7-12(17)16-10/h4-6,8H,3,7H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | ZLCIANQNVWXBKG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |