About N-(cyclopentylmethyl)-3,4-difluoroaniline
N-(cyclopentylmethyl)-3,4-difluoroaniline (PubChem CID 61344637) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-3,4-difluoroaniline.
Molecular Properties
| Compound Name | N-(cyclopentylmethyl)-3,4-difluoroaniline |
| PubChem CID | 61344637 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-(cyclopentylmethyl)-3,4-difluoroaniline |
| SMILES | Fc1ccc(NCC2CCCC2)cc1F |
| InChI | InChI=1S/C12H15F2N/c13-11-6-5-10(7-12(11)14)15-8-9-3-1-2-4-9/h5-7,9,15H,1-4,8H2 |
| InChIKey | VNDFCLJKJLDQKX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclopentylmethyl)-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopentylmethyl)-3,4-difluoroaniline?
The IUPAC name of N-(cyclopentylmethyl)-3,4-difluoroaniline (CID 61344637) is N-(cyclopentylmethyl)-3,4-difluoroaniline.
What is the SMILES notation for N-(cyclopentylmethyl)-3,4-difluoroaniline?
The canonical SMILES for N-(cyclopentylmethyl)-3,4-difluoroaniline is Fc1ccc(NCC2CCCC2)cc1F.
What is the InChIKey of N-(cyclopentylmethyl)-3,4-difluoroaniline?
The InChIKey is VNDFCLJKJLDQKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c13-11-6-5-10(7-12(11)14)15-8-9-3-1-2-4-9/h5-7,9,15H,1-4,8H2.
What are the key properties of N-(cyclopentylmethyl)-3,4-difluoroaniline?
N-(cyclopentylmethyl)-3,4-difluoroaniline has a molecular weight of 211.25 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopentylmethyl)-3,4-difluoroaniline is sourced from PubChem (CID 61344637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).