C12H10FNO — CID 61344681
7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one (PubChem CID 61344681) has the molecular formula C12H10FNO and a molecular weight of 203.22 g/mol. Its IUPAC name is 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one.
| Compound Name | 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 61344681 |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one |
| SMILES | C#CCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H10FNO/c1-2-7-14-11-8-10(13)5-3-9(11)4-6-12(14)15/h1,3,5,8H,4,6-7H2 |
| InChIKey | PQTLFVBNWNFLQU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|