About 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one
7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one (PubChem CID 61344681) has the molecular formula C12H10FNO
and a molecular weight of 203.22 g/mol. Its IUPAC name is 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one |
| PubChem CID | 61344681 |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one |
| SMILES | C#CCN1C(=O)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H10FNO/c1-2-7-14-11-8-10(13)5-3-9(11)4-6-12(14)15/h1,3,5,8H,4,6-7H2 |
| InChIKey | PQTLFVBNWNFLQU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one?
The IUPAC name of 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one (CID 61344681) is 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one.
What is the SMILES notation for 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one?
The canonical SMILES for 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one is C#CCN1C(=O)CCc2ccc(F)cc21.
What is the InChIKey of 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one?
The InChIKey is PQTLFVBNWNFLQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FNO/c1-2-7-14-11-8-10(13)5-3-9(11)4-6-12(14)15/h1,3,5,8H,4,6-7H2.
What are the key properties of 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one?
7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one has a molecular weight of 203.22 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-prop-2-ynyl-3,4-dihydroquinolin-2-one is sourced from PubChem (CID 61344681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).