C8H15N5OS — CID 61345287
N'-hydroxy-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanimidamide (PubChem CID 61345287) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is N'-hydroxy-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanimidamide.
| Compound Name | N'-hydroxy-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanimidamide |
|---|---|
| PubChem CID | 61345287 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N'-hydroxy-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]pentanimidamide |
| SMILES | CCC(CC(N)=NO)Sc1n[nH]c(C)n1 |
| InChI | InChI=1S/C8H15N5OS/c1-3-6(4-7(9)13-14)15-8-10-5(2)11-12-8/h6,14H,3-4H2,1-2H3,(H2,9,13)(H,10,11,12) |
| InChIKey | BUTBVSSARQKHDO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|