C13H16ClN5O — CID 61345497
N-(4-amino-2-chlorophenyl)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propanamide (PubChem CID 61345497) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 61345497 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-2-(3,5-dimethyl-1,2,4-triazol-1-yl)propanamide |
| SMILES | Cc1nc(C)n(C(C)C(=O)Nc2ccc(N)cc2Cl)n1 |
| InChI | InChI=1S/C13H16ClN5O/c1-7(19-9(3)16-8(2)18-19)13(20)17-12-5-4-10(15)6-11(12)14/h4-7H,15H2,1-3H3,(H,17,20) |
| InChIKey | YQFOHIMFEIVLDU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|