C11H10F3N5S — CID 61345688
4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)benzenecarboximidamide (PubChem CID 61345688) has the molecular formula C11H10F3N5S and a molecular weight of 301.30 g/mol. Its IUPAC name is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61345688 |
| Molecular Formula | C11H10F3N5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-2-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Sc2n[nH]c(C)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10F3N5S/c1-5-17-10(19-18-5)20-6-2-3-7(9(15)16)8(4-6)11(12,13)14/h2-4H,1H3,(H3,15,16)(H,17,18,19) |
| InChIKey | NROAMCUMYSASCF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|