About 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid
5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid (PubChem CID 61345746) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid |
| PubChem CID | 61345746 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1nc(C2CCCC2)n[nH]1 |
| InChI | InChI=1S/C12H19N3O2/c16-11(17)8-4-3-7-10-13-12(15-14-10)9-5-1-2-6-9/h9H,1-8H2,(H,16,17)(H,13,14,15) |
| InChIKey | OLDJDXANKAJPPM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid?
The IUPAC name of 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid (CID 61345746) is 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid.
What is the SMILES notation for 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid?
The canonical SMILES for 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid is O=C(O)CCCCc1nc(C2CCCC2)n[nH]1.
What is the InChIKey of 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid?
The InChIKey is OLDJDXANKAJPPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c16-11(17)8-4-3-7-10-13-12(15-14-10)9-5-1-2-6-9/h9H,1-8H2,(H,16,17)(H,13,14,15).
What are the key properties of 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid?
5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid has a molecular weight of 237.30 g/mol, XLogP of 2.26, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyclopentyl-1H-1,2,4-triazol-5-yl)pentanoic acid is sourced from PubChem (CID 61345746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).