C11H11FN4S — CID 61345924
4-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-fluorobenzenecarbothioamide (PubChem CID 61345924) has the molecular formula C11H11FN4S and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 61345924 |
| Molecular Formula | C11H11FN4S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 4-(3,5-dimethyl-1,2,4-triazol-1-yl)-3-fluorobenzenecarbothioamide |
| SMILES | Cc1nc(C)n(-c2ccc(C(N)=S)cc2F)n1 |
| InChI | InChI=1S/C11H11FN4S/c1-6-14-7(2)16(15-6)10-4-3-8(11(13)17)5-9(10)12/h3-5H,1-2H3,(H2,13,17) |
| InChIKey | TZEJWAFJOGYNKX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|