C9H8F2N4S — CID 61346081
3,5-difluoro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline (PubChem CID 61346081) has the molecular formula C9H8F2N4S and a molecular weight of 242.25 g/mol. Its IUPAC name is 3,5-difluoro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline.
| Compound Name | 3,5-difluoro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 61346081 |
| Molecular Formula | C9H8F2N4S |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3,5-difluoro-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]aniline |
| SMILES | Cc1nc(Sc2c(F)cc(N)cc2F)n[nH]1 |
| InChI | InChI=1S/C9H8F2N4S/c1-4-13-9(15-14-4)16-8-6(10)2-5(12)3-7(8)11/h2-3H,12H2,1H3,(H,13,14,15) |
| InChIKey | GVAAZJBZVKUFLU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|