C12H15N5O — CID 61346129
2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 61346129) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 61346129 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | Cc1nc(C)n(Cc2ccccc2C(N)=NO)n1 |
| InChI | InChI=1S/C12H15N5O/c1-8-14-9(2)17(15-8)7-10-5-3-4-6-11(10)12(13)16-18/h3-6,18H,7H2,1-2H3,(H2,13,16) |
| InChIKey | VQBHHTYFHQSAKH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|