C8H15N5O — CID 61346326
3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide (PubChem CID 61346326) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 61346326 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)-N'-hydroxybutanimidamide |
| SMILES | Cc1nc(C)n(C(C)CC(N)=NO)n1 |
| InChI | InChI=1S/C8H15N5O/c1-5(4-8(9)12-14)13-7(3)10-6(2)11-13/h5,14H,4H2,1-3H3,(H2,9,12) |
| InChIKey | MHNPSVXYASSPLQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|