About 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine
2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine (PubChem CID 61346341) has the molecular formula C8H8ClN5
and a molecular weight of 209.64 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine.
Molecular Properties
| Compound Name | 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine |
| PubChem CID | 61346341 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine |
| SMILES | Cc1nc(C)n(-c2cncc(Cl)n2)n1 |
| InChI | InChI=1S/C8H8ClN5/c1-5-11-6(2)14(13-5)8-4-10-3-7(9)12-8/h3-4H,1-2H3 |
| InChIKey | YLUHWCLYLNPKGF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine?
The IUPAC name of 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine (CID 61346341) is 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine.
What is the SMILES notation for 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine?
The canonical SMILES for 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine is Cc1nc(C)n(-c2cncc(Cl)n2)n1.
What is the InChIKey of 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine?
The InChIKey is YLUHWCLYLNPKGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN5/c1-5-11-6(2)14(13-5)8-4-10-3-7(9)12-8/h3-4H,1-2H3.
What are the key properties of 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine?
2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine has a molecular weight of 209.64 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrazine is sourced from PubChem (CID 61346341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).