C12H17N3O2 — CID 61346348
6-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 61346348) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 61346348 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(C)c1n[nH]c(C2CC=CCC2C(=O)O)n1 |
| InChI | InChI=1S/C12H17N3O2/c1-7(2)10-13-11(15-14-10)8-5-3-4-6-9(8)12(16)17/h3-4,7-9H,5-6H2,1-2H3,(H,16,17)(H,13,14,15) |
| InChIKey | LJNADHUXMHEVGF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|