About 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine
2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine (PubChem CID 613466) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine |
| PubChem CID | 613466 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine |
| SMILES | CC1CC(c2ccccc2)=Nc2ccccc2N1 |
| InChI | InChI=1S/C16H16N2/c1-12-11-16(13-7-3-2-4-8-13)18-15-10-6-5-9-14(15)17-12/h2-10,12,17H,11H2,1H3 |
| InChIKey | ZFYHRUSMZXQQFT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine?
The IUPAC name of 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine (CID 613466) is 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine.
What is the SMILES notation for 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine?
The canonical SMILES for 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine is CC1CC(c2ccccc2)=Nc2ccccc2N1.
What is the InChIKey of 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine?
The InChIKey is ZFYHRUSMZXQQFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2/c1-12-11-16(13-7-3-2-4-8-13)18-15-10-6-5-9-14(15)17-12/h2-10,12,17H,11H2,1H3.
What are the key properties of 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine?
2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine has a molecular weight of 236.32 g/mol, XLogP of 4.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyl-2,3-dihydro-1H-1,5-benzodiazepine is sourced from PubChem (CID 613466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).