methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate

C14H14ClNO2S — CID 61347171

IUPACmethyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate
SMILESCOC(=O)C(Nc1ccc(Cl)cc1)c1ccc(C)s1
InChIInChI=1S/C14H14ClNO2S/c1-9-3-8-12(19-9)13(14(17)18-2)16-11-6-4-10(15)5-7-11/h3-8,13,16H,1-2H3
InChIKeySZEWMKLPBRUBEU-UHFFFAOYSA-N
MW295.79 g/mol
LogP4.04
Rot. Bonds4

About methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate

methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate (PubChem CID 61347171) has the molecular formula C14H14ClNO2S and a molecular weight of 295.79 g/mol. Its IUPAC name is methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate
PubChem CID61347171
Molecular FormulaC14H14ClNO2S
Molecular Weight295.79 g/mol
Exact Mass295.04
IUPAC Namemethyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate
SMILESCOC(=O)C(Nc1ccc(Cl)cc1)c1ccc(C)s1
InChIInChI=1S/C14H14ClNO2S/c1-9-3-8-12(19-9)13(14(17)18-2)16-11-6-4-10(15)5-7-11/h3-8,13,16H,1-2H3
InChIKeySZEWMKLPBRUBEU-UHFFFAOYSA-N
XLogP4.04
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.79
LogP ≤ 54.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate?
The IUPAC name of methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate (CID 61347171) is methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate.
What is the SMILES notation for methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate?
The canonical SMILES for methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate is COC(=O)C(Nc1ccc(Cl)cc1)c1ccc(C)s1.
What is the InChIKey of methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate?
The InChIKey is SZEWMKLPBRUBEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO2S/c1-9-3-8-12(19-9)13(14(17)18-2)16-11-6-4-10(15)5-7-11/h3-8,13,16H,1-2H3.
What are the key properties of methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate?
methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate has a molecular weight of 295.79 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-chloroanilino)-2-(5-methylthiophen-2-yl)acetate is sourced from PubChem (CID 61347171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).