About [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine
[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine (PubChem CID 61347263) has the molecular formula C13H24N4S
and a molecular weight of 268.43 g/mol. Its IUPAC name is [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine.
Molecular Properties
| Compound Name | [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine |
| PubChem CID | 61347263 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(Sc2n[nH]c(C)n2)C1 |
| InChI | InChI=1S/C13H24N4S/c1-3-4-10-5-6-11(8-14)12(7-10)18-13-15-9(2)16-17-13/h10-12H,3-8,14H2,1-2H3,(H,15,16,17) |
| InChIKey | DVHZOZQISVYYTK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine?
The IUPAC name of [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine (CID 61347263) is [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine.
What is the SMILES notation for [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine?
The canonical SMILES for [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine is CCCC1CCC(CN)C(Sc2n[nH]c(C)n2)C1.
What is the InChIKey of [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine?
The InChIKey is DVHZOZQISVYYTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4S/c1-3-4-10-5-6-11(8-14)12(7-10)18-13-15-9(2)16-17-13/h10-12H,3-8,14H2,1-2H3,(H,15,16,17).
What are the key properties of [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine?
[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine has a molecular weight of 268.43 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-4-propylcyclohexyl]methanamine is sourced from PubChem (CID 61347263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).