C11H20N4 — CID 61347285
2-(3,5-dimethyl-1,2,4-triazol-1-yl)cycloheptan-1-amine (PubChem CID 61347285) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2,4-triazol-1-yl)cycloheptan-1-amine.
| Compound Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 61347285 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-(3,5-dimethyl-1,2,4-triazol-1-yl)cycloheptan-1-amine |
| SMILES | Cc1nc(C)n(C2CCCCCC2N)n1 |
| InChI | InChI=1S/C11H20N4/c1-8-13-9(2)15(14-8)11-7-5-3-4-6-10(11)12/h10-11H,3-7,12H2,1-2H3 |
| InChIKey | RIHBGNHHPMQCAO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |